Butallylonal: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Chemical compound}}
-{{drugbox | verifiedrevid = 399698007
+{{Drugbox
-|
+| Watchedfields = changed
-| IUPAC_name        = 5-''sec''-Butyl-5-(beta-bromoallyl)barbituric acid
+| verifiedrevid = 414038144
-| image             = Butallylonal structure.svg
+| IUPAC_name = 5-''sec''-Butyl-5-(beta-bromoallyl)barbituric acid
-| width             = 155
+| image = Butallylonal structure.svg
+| width = 155
+<!--Clinical data-->
+| tradename =
+| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
+| pregnancy_US = <!-- A / B            / C / D / X -->
+| pregnancy_category =
+| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
+| legal_CA = Schedule IV
+| legal_UK = <!-- GSL         / P       / POM / CD / Class A, B, C -->
+| legal_US = <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
+| legal_status =
+| routes_of_administration =
+<!--Pharmacokinetic data-->
+| bioavailability =
+| protein_bound =
+| metabolism =
+| elimination_half-life =
+| excretion =
+<!--Identifiers-->
+| CAS_number_Ref = {{cascite|correct|??}}
+| CAS_number = 1142-70-7
+| UNII_Ref = {{fdacite|correct|FDA}}
+| UNII = H223WHY93B
+| ATC_prefix = none
+| ATC_suffix =
+| PubChem = 14362
+| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
+| DrugBank =
 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
-| ChemSpiderID      = 13723
+| ChemSpiderID = 13723
+| ChEMBL_Ref = {{ebicite|correct|EBI}}
-| InChI             = 1/C11H15BrN2O3/c1-4-6(2)11(5-7(3)12)8(15)13-10(17)14-9(11)16/h6H,3-5H2,1-2H3,(H2,13,14,15,16,17)
-| smiles            = O=C1NC(=O)NC(=O)C1(C(C)CC)CC(\Br)=C
-| InChIKey          = FWZMBTIUIQUJFF-UHFFFAOYAI
 | ChEMBL = 469253
+<!--Chemical data-->
+| C=11 | H=15 | Br=1 | N=2 | O=3
+| smiles = O=C1NC(=O)NC(=O)C1(C(C)CC)CC(\Br)=C
 | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChI = 1S/C11H15BrN2O3/c1-4-6(2)11(5-7(3)12)8(15)13-10(17)14-9(11)16/h6H,3-5H2,1-2H3,(H2,13,14,15,16,17)
 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChIKey = FWZMBTIUIQUJFF-UHFFFAOYSA-N
-| CAS_number        = 1142-70-7
-| ATC_prefix        = none
-| ATC_suffix        =
-| PubChem = 14362
-| DrugBank          =
-| C=11|H=15|Br=1|N=2|O=3
-| molecular_weight  = 303.15 g/mol
-| bioavailability   =
-| protein_bound     =
-| metabolism        =
-| elimination_half-life =
-| excretion         =
-| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
-| pregnancy_US      =  <!-- A / B            / C / D / X -->
-| pregnancy_category=
-| legal_AU          =  <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
-| legal_CA          =  <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
-| legal_UK          =  <!-- GSL         / P       / POM / CD / Class A, B, C -->
-| legal_US          =  <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
-| legal_status      =
-| routes_of_administration =
 }}
-'''Butallylonal''' is a [[barbiturate]] derivative invented in the 1920s.<ref>{{cite patent|country=US|number=1739662}}</ref> It has [[sedative]] properties, and was used primarily as an anaesthetic in [[veterinary]] medicine.<ref>{{cite journal | doi = 10.1007/BF01907782 | author = Mittmann U, Schmidt HD, Schmier J, Wirth RH | title = Hemorrhagic shock with fixed hypotension and with spontaneous recovery of blood pressure. A comparison of two shock models | journal = Basic Research in Cardiology | year = 1976 | volume = 71 | issue = 1 | pages = 47–59 | pmid = 1259685}}</ref>  Butallylonal is considered similar in effects to [[pentobarbital]] but is longer in action, being considered an intermediate-acting barbiturate rather than short-acting.
+'''Butallylonal''' is a [[barbiturate]] derivative invented in the 1920s.<ref>{{cite patent|country=US|number=1739662}}</ref> It has [[sedative]] properties, and was used primarily as an anaesthetic in [[veterinary]] medicine.<ref>{{cite journal | doi = 10.1007/BF01907782 | vauthors = Mittmann U, Schmidt HD, Schmier J, Wirth RH | title = Hemorrhagic shock with fixed hypotension and with spontaneous recovery of blood pressure. A comparison of two shock models | journal = Basic Research in Cardiology | year = 1976 | volume = 71 | issue = 1 | pages = 47–59 | pmid = 1259685| s2cid = 5567045 }}</ref>  Butallylonal is considered similar in effects to [[pentobarbital]] but is longer in action, being considered an intermediate-acting barbiturate rather than short-acting.
 == References ==
 {{reflist}}
-{{barbiturates}}
+{{GABAAR PAMs}}
-{{pharma-stub}}
 [[Category:Barbiturates]]
 [[Category:Organobromides]]
-[[Category:Alkenes]]
+[[Category:Alkene derivatives]]
+{{sedative-stub}}
-[[de:Butallylonal]]