Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Reposal: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 456719379 of page Reposal for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number'). |
No edit summary |
||
| Line 1: | Line 1: | ||
{{short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Reposal|oldid=456719379}} 456719379] of page [[Reposal]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| verifiedrevid = |
| verifiedrevid = 464380919 |
||
| IUPAC_name = 5-bicyclo[3.2.1]oct-2-en-3-yl-5-ethylpyrimidine-2,4,6(1''H'',3''H'',5''H'')-trione |
| IUPAC_name = 5-bicyclo[3.2.1]oct-2-en-3-yl-5-ethylpyrimidine-2,4,6(1''H'',3''H'',5''H'')-trione |
||
| image = |
| image = Reposal structure.svg |
||
| width = |
| width = 135 |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| Line 27: | Line 27: | ||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite| |
| CAS_number_Ref = {{cascite|changed|??}} |
||
| CAS_number = |
| CAS_number = 3625-25-0 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = 3T5TIX1AYI |
|||
| ATC_prefix = N05 |
| ATC_prefix = N05 |
||
| ATC_suffix = CA12 |
| ATC_suffix = CA12 |
||
| Line 37: | Line 39: | ||
| ChemSpiderID = 10468690 |
| ChemSpiderID = 10468690 |
||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
||
| ChEMBL = |
| ChEMBL = 505851 |
||
<!--Chemical data--> |
|||
| C=14 | H=18 | N=2 | O=3 |
| C=14 | H=18 | N=2 | O=3 |
||
| molecular_weight = 262.304 g/mol |
|||
| smiles = O=C1NC(=O)NC(=O)C1(CC)C=3C[C@H]2C[C@H](CC2)C=3 |
| smiles = O=C1NC(=O)NC(=O)C1(CC)C=3C[C@H]2C[C@H](CC2)C=3 |
||
| InChI = 1/C14H18N2O3/c1-2-14(11(17)15-13(19)16-12(14)18)10-6-8-3-4-9(5-8)7-10/h6,8-9H,2-5,7H2,1H3,(H2,15,16,17,18,19)/t8-,9+/m0/s1 |
|||
| InChIKey = MKELYWOVSPVORM-DTWKUNHWBZ |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C14H18N2O3/c1-2-14(11(17)15-13(19)16-12(14)18)10-6-8-3-4-9(5-8)7-10/h6,8-9H,2-5,7H2,1H3,(H2,15,16,17,18,19)/t8-,9+/m0/s1 |
| StdInChI = 1S/C14H18N2O3/c1-2-14(11(17)15-13(19)16-12(14)18)10-6-8-3-4-9(5-8)7-10/h6,8-9H,2-5,7H2,1H3,(H2,15,16,17,18,19)/t8-,9+/m0/s1 |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = MKELYWOVSPVORM-DTWKUNHWSA-N |
| StdInChIKey = MKELYWOVSPVORM-DTWKUNHWSA-N |
||
| synonyms = |
| synonyms = Reposamal, 5-Ethyl-5-(bicyclo(3.2.1)octenyl)barbituric acid |
||
}} |
}} |
||
'''Reposal''' is a [[barbiturate]] derivative invented in the 1960s in Denmark. It has [[sedative]], [[hypnotic]] and [[anticonvulsant]] properties, and was used primarily for the treatment of [[insomnia]].<ref>{{cite journal | vauthors = Kessing SV, Tarding F, Thomsen AC | language = Danish | journal = Ugeskrift for Laeger | volume = 125 | pages = 1735–8 | date = December 1963 | pmid = 14103836 | title = Reposal, A New Hypnotic. I. Pharmacodynamic Activity }}</ref><ref>{{cite journal | vauthors = Kessing SV, Tarding F, Thomsen AC | language = Danish | journal = Ugeskrift for Laeger | volume = 125 | pages = 1739–41 | date = December 1963 | pmid = 14103837 | title = Reposal, A New Hypnotic. Ii. Clinical Effects }}</ref><ref>{{cite journal | vauthors = Nielsen P, Tarding F | title = The metabolic fate of 5-(bicyclo-3,2,1,-oct-2-en-2-yl)-5-ethyl barbituric acid, (Reposal) | journal = Acta Pharmacologica et Toxicologica | volume = 26 | issue = 6 | pages = 521–30 | year = 1968 | pmid = 5756387 | doi = 10.1111/j.1600-0773.1968.tb00471.x }}</ref> |
|||
== References == |
|||
{{reflist}} |
|||
{{Hypnotics and sedatives}} |
|||
{{GABAAR PAMs}} |
|||
[[Category:Barbiturates]] |
|||
{{sedative-stub}} |
|||