Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Thyronine: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{chembox}} taken from revid 444228706 of page Thyronine for the Chem/Drugbox validation project (updated: 'CASNo'). |
Trying to make a sentence out of it. |
||
| Line 1: | Line 1: | ||
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Thyronine|oldid=444228706}} 444228706] of page [[Thyronine]] with values updated to verified values.}} |
|||
{{chembox |
{{chembox |
||
| Verifiedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 470609868 |
||
| Name=<small>L</small>-Thyronine |
|||
| |
| Name={{small|L}}-Thyronine |
||
| ImageFile=Thyronine.png |
|||
|ImageSize= |
| ImageSize=230px |
||
| ⚫ | |||
| ImageAlt=Skeletal formula of {{small|L}}-thyronine |
|||
| ⚫ | |||
| ImageFile1 = L-Thyronine zwitterion 3D ball.png |
|||
| ImageSize1 = 240 |
|||
| ImageAlt1 = Ball-and-stick model of the {{small|L}}-thyronine molecule as a zwitterion |
|||
| IUPACName = ''O''-(4-Hydroxyphenyl)-{{small|L}}-tyrosine |
|||
| ⚫ | |||
| ⚫ | |||
|Section1={{Chembox Identifiers |
|Section1={{Chembox Identifiers |
||
| |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 4574450 |
| ChemSpiderID = 4574450 |
||
| InChI = 1/C15H15NO4/c16-14(15(18)19)9-10-1-5-12(6-2-10)20-13-7-3-11(17)4-8-13/h1-8,14,17H,9,16H2,(H,18,19)/t14-/m0/s1 |
| InChI = 1/C15H15NO4/c16-14(15(18)19)9-10-1-5-12(6-2-10)20-13-7-3-11(17)4-8-13/h1-8,14,17H,9,16H2,(H,18,19)/t14-/m0/s1 |
||
| Line 16: | Line 21: | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = KKCIOUWDFWQUBT-AWEZNQCLSA-N |
| StdInChIKey = KKCIOUWDFWQUBT-AWEZNQCLSA-N |
||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| CASNo = <!-- blanked - oldvalue: 1596-67-4 --> |
|||
| CASNo = 1596-67-4 |
|||
| ⚫ | |||
| |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = E4QN8G00CV |
|||
| ⚫ | |||
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|||
| ChEBI = 30662 |
| ChEBI = 30662 |
||
| SMILES = O=C(O)[C@@H](N)Cc2ccc(Oc1ccc(O)cc1)cc2 |
| SMILES = O=C(O)[C@@H](N)Cc2ccc(Oc1ccc(O)cc1)cc2 |
||
}} |
}} |
||
|Section2={{Chembox Properties |
|Section2={{Chembox Properties |
||
| |
| Formula=C<sub>15</sub>H<sub>15</sub>NO<sub>4</sub> |
||
| |
| MolarMass=273.28 g/mol |
||
| |
| Appearance= |
||
| |
| Density= |
||
| |
| MeltingPt= |
||
| |
| BoilingPt= |
||
| |
| Solubility= |
||
}} |
}} |
||
|Section3={{Chembox Hazards |
|Section3={{Chembox Hazards |
||
| |
| MainHazards= |
||
| |
| FlashPt= |
||
| AutoignitionPt = |
|||
| Autoignition= |
|||
}} |
}} |
||
}} |
}} |
||
'''Thyronine''' is a metabolite derived from [[thyroxine]] and [[triiodothyronine]] via the peripheral enzymatic removal of iodines from the thyroxine nucleus. Thyronine is the thyroxine nucleus devoid of its four iodine atoms.<ref>[https://pubchem.ncbi.nlm.nih.gov/compound/L-Thyronine Pubchem] Compound summary, L-thyronine</ref> |
|||
==References== |
|||
{{reflist}} |
|||
{{organic-compound-stub}} |
|||
{{Thyroid hormone intermediates}} |
|||
[[Category:Alpha-Amino acids]] |
|||