About: RTI-121

An Entity of Type: chemical substance, from Named Graph: http://dbpedia.org, within Data Space: dbpedia.org

(–)-2β-Carboisopropoxy-3β-(4-iodophenyl)tropane (RTI-4229-121, IPCIT) is a stimulant drug used in scientific research, which was developed in the early 1990s. RTI-121 is a phenyltropane based, highly selective dopamine reuptake inhibitor and is derived from methylecgonidine. RTI-121 is a potent and long-lasting stimulant, producing stimulant effects for more than 10 hours after a single dose in mice which would limit its potential uses in humans, as it might have significant abuse potential if used outside a medical setting. However RTI-121 occupies the dopamine transporter more slowly than cocaine, and so might have lower abuse potential than cocaine itself.

Property	Value
dbo:abstract	(–)-2β-Carboisopropoxy-3β-(4-iodophenyl)tropane (RTI-4229-121, IPCIT) is a stimulant drug used in scientific research, which was developed in the early 1990s. RTI-121 is a phenyltropane based, highly selective dopamine reuptake inhibitor and is derived from methylecgonidine. RTI-121 is a potent and long-lasting stimulant, producing stimulant effects for more than 10 hours after a single dose in mice which would limit its potential uses in humans, as it might have significant abuse potential if used outside a medical setting. However RTI-121 occupies the dopamine transporter more slowly than cocaine, and so might have lower abuse potential than cocaine itself. (en)
dbo:casNumber	146145-21-3
dbo:pubchem	122190
dbo:thumbnail	wiki-commons:Special:FilePath/Phenyltropane_25a.svg?width=300
dbo:wikiPageID	13816093 (xsd:integer)
dbo:wikiPageLength	6689 (xsd:nonNegativeInteger)
dbo:wikiPageRevisionID	1082826202 (xsd:integer)
dbo:wikiPageWikiLink	dbr:Dopamine_reuptake_inhibitor dbr:Dopamine_transporter dbc:Dopamine_reuptake_inhibitors dbc:Iodoarenes dbc:Tropanes dbr:Cocaine dbr:Brain dbr:Stimulant dbc:Medical_imaging dbc:Neuroimaging dbc:RTI_compounds dbr:Isotopic_labeling dbr:List_of_cocaine_analogues dbr:Drug_abuse dbr:Iodine dbr:Isotopes dbr:Federal_Analog_Act dbc:Sympathomimetic_amines dbr:Dopamine dbr:Methylecgonidine dbr:RTI-55 dbr:Phenyltropane dbr:List_of_Phenyltropanes dbr:Iometopane
dbp:c	18 (xsd:integer)
dbp:casNumber	146145 (xsd:integer)
dbp:chemspiderid	21106374 (xsd:integer)
dbp:h	24 (xsd:integer)
dbp:i	1 (xsd:integer)
dbp:iupacName	Propan-2-yl -3--8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (en)
dbp:legalStatus	Unscheduled (en)
dbp:n	1 (xsd:integer)
dbp:o	2 (xsd:integer)
dbp:pubchem	122190 (xsd:integer)
dbp:smiles	CN3[C@@H]1CCC3C[C@@H]c2ccccc2 (en)
dbp:stdinchi	1 (xsd:integer)
dbp:stdinchikey	ZAQLTGAFVMGUMB-IFFAKLHKSA-N (en)
dbp:verifiedrevid	401038485 (xsd:integer)
dbp:width	160 (xsd:integer)
dbp:wikiPageUsesTemplate	dbt:Drugbox dbt:Reflist dbt:Short_description dbt:Stimulants dbt:Chemspidercite dbt:Stdinchicite dbt:Phenyltropanes dbt:Monoamine_reuptake_inhibitors
dcterms:subject	dbc:Dopamine_reuptake_inhibitors dbc:Iodoarenes dbc:Tropanes dbc:Medical_imaging dbc:Neuroimaging dbc:RTI_compounds dbc:Sympathomimetic_amines
gold:hypernym	dbr:Drug
rdf:type	owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 yago:Abstraction100002137 yago:AliphaticCompound114601294 yago:Amine114739004 yago:Chemical114806838 yago:Cognition100023271 yago:Compound105870180 yago:Compound114818238 yago:Concept105835747 yago:Content105809192 yago:Idea105833840 yago:Material114580897 yago:Matter100020827 yago:MethaneSeries114951377 yago:OrganicCompound114727670 yago:Part113809207 yago:PhysicalEntity100001930 yago:PsychologicalFeature100023100 yago:Relation100031921 dbo:Drug yago:Substance100019613 yago:Whole105869584 yago:WikicatRTICompounds yago:WikicatSympathomimeticAmines
rdfs:comment	(–)-2β-Carboisopropoxy-3β-(4-iodophenyl)tropane (RTI-4229-121, IPCIT) is a stimulant drug used in scientific research, which was developed in the early 1990s. RTI-121 is a phenyltropane based, highly selective dopamine reuptake inhibitor and is derived from methylecgonidine. RTI-121 is a potent and long-lasting stimulant, producing stimulant effects for more than 10 hours after a single dose in mice which would limit its potential uses in humans, as it might have significant abuse potential if used outside a medical setting. However RTI-121 occupies the dopamine transporter more slowly than cocaine, and so might have lower abuse potential than cocaine itself. (en)
rdfs:label	RTI-121 (en)
owl:sameAs	freebase:RTI-121 yago-res:RTI-121 wikidata:RTI-121 dbpedia-sh:RTI-121 dbpedia-sr:RTI-121 https://global.dbpedia.org/id/4tWg7
prov:wasDerivedFrom	wikipedia-en:RTI-121?oldid=1082826202&ns=0
foaf:depiction	wiki-commons:Special:FilePath/Phenyltropane_25a.svg
foaf:isPrimaryTopicOf	wikipedia-en:RTI-121
is dbo:wikiPageWikiLink of	dbr:List_of_dopaminergic_drugs dbr:List_of_phenyltropanes dbr:RTI-229 dbr:RTI-51 dbr:RTI-55 dbr:RTI-120
is foaf:primaryTopic of	wikipedia-en:RTI-121

This content was extracted from Wikipedia and is licensed under the Creative Commons Attribution-ShareAlike 3.0 Unported License