Location via proxy:   [ UP ]  
[Report a bug]   [Manage cookies]                
Jump to content

L-AP4: Difference between revisions

From Wikipedia, the free encyclopedia
Browse history interactively
← Previous edit
Content deleted Content added
VisualWikitext
m Remove redundant parameters InChI, InChIKey (StdInChI, StdInChIKey are used). See Talk (via AWB script)
 
(10 intermediate revisions by 8 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| Verifiedfields = changed
| Watchedfields = changed
| Watchedfields = changed
| verifiedrevid = 451227757
| verifiedrevid = 451227757
| IUPAC_name = (2S)-2-amino-4-phosphonobutanoic acid
| IUPAC_name = (2''S'')-2-Amino-4-phosphonobutanoic acid
| image = L-AP4_structure.png
| image = L-2-amino-4-phosphonobutyric acid L-AP4.svg
| width = 200
| width = 200


Line 27: Line 28:


<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 23052-81-5
| CAS_number = 23052-81-5
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = C8M58SS68H
| ATC_prefix =
| ATC_prefix =
| ATC_suffix =
| ATC_suffix =
Line 35: Line 38:
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 156157
| ChemSpiderID = 156157
| synonyms = <small>L</small>-2-Amino-4-phosphonobutyric acid


<!--Chemical data-->
<!--Chemical data-->
| C=4 | H=10 | N=1 | O=5 | P=1
| C=4 | H=10 | N=1 | O=5 | P=1
| molecular_weight = 183.099 g/mol
| smiles = C(CP(=O)(O)O)[C@@H](C(=O)O)N
| smiles = C(CP(=O)(O)O)[C@@H](C(=O)O)N
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
Line 48: Line 51:
}}
}}


'''L-2-amino-4-phosphonobutyric acid''' (or '''L-AP4''') is a drug used in scientific research, which acts as a group-selective [[agonist]] for the group III [[metabotropic glutamate receptor]]s ([[Metabotropic glutamate receptor 4|mGluR<sub>4</sub>]]<sub>/</sub>[[Metabotropic glutamate receptor 6|<sub>6</sub>]]<sub>/</sub>[[Metabotropic glutamate receptor 7|<sub>7</sub>]]<sub>/</sub>[[Metabotropic glutamate receptor 8|<sub>8</sub>]]). It was the first ligand found to act as an agonist selective for this group of mGlu receptors,<ref>{{cite journal | last1 = Thomsen | first1 = C | title = The L-AP4 receptor | journal = General pharmacology | volume = 29 | issue = 2 | pages = 151–8 | year = 1997 | pmid = 9251893 |name-list-format=vanc | doi=10.1016/S0306-3623(96)00417-X}}</ref> but does not show selectivity between the different mGluR Group III subtypes. It is widely used in the study of this receptor family and their various functions.<ref>{{cite journal | last1 = Lopez | first1 = S | last2 = Turle-Lorenzo | first2 = N | last3 = Acher | first3 = F | last4 = De Leonibus | first4 = E | last5 = Mele | first5 = A | last6 = Amalric | first6 = M | title = Targeting group III metabotropic glutamate receptors produces complex behavioral effects in rodent models of Parkinson's disease | journal = Journal of Neuroscience | volume = 27 | issue = 25 | pages = 6701–11 | year = 2007 | pmid = 17581957 |name-list-format=vanc | doi = 10.1523/JNEUROSCI.0299-07.2007 }}</ref><ref>{{cite journal | last1 = MacInnes | first1 = N | last2 = Duty | first2 = S | title = Group III metabotropic glutamate receptors act as hetero-receptors modulating evoked GABA release in the globus pallidus in vivo | journal = European Journal of Pharmacology | volume = 580 | issue = 1–2 | pages = 95–9 | year = 2008 | pmid = 18035348 |name-list-format=vanc | doi = 10.1016/j.ejphar.2007.10.030 }}</ref><ref>{{cite journal | last1 = Zhang | first1 = HM | last2 = Chen | first2 = SR | last3 = Pan | first3 = HL | title = Effects of Activation of Group III Metabotropic Glutamate Receptors on Spinal Synaptic Transmission in a Rat Model of Neuropathic Pain | journal = Neuroscience | volume = 158 | issue = 2 | pages = 875–84 | year = 2009 | pmid = 19017536 |name-list-format=vanc | pmc = 2649787 | doi = 10.1016/j.neuroscience.2008.10.042 }}</ref><ref>{{cite journal | last1 = MacIejak | first1 = P | last2 = Szyndler | first2 = J | last3 = Turzyńska | first3 = D | last4 = Sobolewska | first4 = A | last5 = Taracha | first5 = E | last6 = Skórzewska | first6 = A | last7 = Lehner | first7 = M | last8 = Bidziński | first8 = A | last9 = Hamed | first9 = A | last10 = Wisłowska-Stanek | first10 = Aleksandra | last11 = Płaźnik | first11 = Adam | title = The effects of group III mGluR ligands on pentylenetetrazol-induced kindling of seizures and hippocampal amino acids concentration | journal = Brain Research | volume = 1282 | pages = 20–7 | year = 2009 | pmid = 19481536 |name-list-format=vanc | doi = 10.1016/j.brainres.2009.05.049 }}</ref>
'''L-AP4''' ('''<small>L</small>-2-amino-4-phosphonobutyric acid''') is a drug used in scientific research, which acts as a group-selective [[agonist]] for the group III [[metabotropic glutamate receptor]]s ([[Metabotropic glutamate receptor 4|mGluR<sub>4</sub>]]<sub>/</sub>[[Metabotropic glutamate receptor 6|<sub>6</sub>]]<sub>/</sub>[[Metabotropic glutamate receptor 7|<sub>7</sub>]]<sub>/</sub>[[Metabotropic glutamate receptor 8|<sub>8</sub>]]). It was the first ligand found to act as an agonist selective for this group of mGlu receptors,<ref>{{cite journal | vauthors = Thomsen C | title = The L-AP4 receptor | journal = General Pharmacology | volume = 29 | issue = 2 | pages = 151–8 | date = August 1997 | pmid = 9251893 | doi = 10.1016/S0306-3623(96)00417-X }}</ref> but does not show selectivity between the different mGluR Group III subtypes. It is widely used in the study of this receptor family and their various functions.<ref>{{cite journal | vauthors = Lopez S, Turle-Lorenzo N, Acher F, De Leonibus E, Mele A, Amalric M | title = Targeting group III metabotropic glutamate receptors produces complex behavioral effects in rodent models of Parkinson's disease | journal = The Journal of Neuroscience | volume = 27 | issue = 25 | pages = 6701–11 | date = June 2007 | pmid = 17581957 | pmc = 6672706 | doi = 10.1523/JNEUROSCI.0299-07.2007 | url = https://hal.archives-ouvertes.fr/hal-00165896/document }}</ref><ref>{{cite journal | vauthors = Macinnes N, Duty S | title = Group III metabotropic glutamate receptors act as hetero-receptors modulating evoked GABA release in the globus pallidus in vivo | journal = European Journal of Pharmacology | volume = 580 | issue = 1–2 | pages = 95–9 | date = February 2008 | pmid = 18035348 | doi = 10.1016/j.ejphar.2007.10.030 }}</ref><ref>{{cite journal | vauthors = Zhang HM, Chen SR, Pan HL | title = Effects of activation of group III metabotropic glutamate receptors on spinal synaptic transmission in a rat model of neuropathic pain | journal = Neuroscience | volume = 158 | issue = 2 | pages = 875–84 | date = January 2009 | pmid = 19017536 | pmc = 2649787 | doi = 10.1016/j.neuroscience.2008.10.042 }}</ref><ref>{{cite journal | vauthors = Maciejak P, Szyndler J, Turzyńska D, Sobolewska A, Taracha E, Skórzewska A, Lehner M, Bidziński A, Hamed A, Wisłowska-Stanek A, Płaźnik A | display-authors = 6 | title = The effects of group III mGluR ligands on pentylenetetrazol-induced kindling of seizures and hippocampal amino acids concentration | journal = Brain Research | volume = 1282 | pages = 20–7 | date = July 2009 | pmid = 19481536 | doi = 10.1016/j.brainres.2009.05.049 | s2cid = 20844494 }}</ref>


==References==
== References ==
{{Reflist|2}}
{{Reflist|2}}


{{Metabotropic glutamate receptor modulators}}
{{Glutamatergics}}


[[Category:Amino acids]]
[[Category:Alpha-Amino acids]]
[[Category:Phosphonic acids]]
[[Category:Phosphonic acids]]
[[Category:MGlu4 receptor agonists]]
[[Category:MGlu4 receptor agonists]]
Line 61: Line 64:
[[Category:MGlu7 receptor agonists]]
[[Category:MGlu7 receptor agonists]]
[[Category:MGlu8 receptor agonists]]
[[Category:MGlu8 receptor agonists]]



{{nervous-system-drug-stub}}
{{nervous-system-drug-stub}}

Latest revision as of 16:54, 17 September 2023

L-AP4
Clinical data
Other namesL-2-Amino-4-phosphonobutyric acid
Identifiers
  • (2S)-2-Amino-4-phosphonobutanoic acid
CAS Number
PubChem CID
IUPHAR/BPS
ChemSpider
UNII
CompTox Dashboard (EPA)
ECHA InfoCard100.164.384 Edit this at Wikidata
Chemical and physical data
FormulaC4H10NO5P
Molar mass183.100 g·mol−1
3D model (JSmol)
  • C(CP(=O)(O)O)[C@@H](C(=O)O)N
  • InChI=1S/C4H10NO5P/c5-3(4(6)7)1-2-11(8,9)10/h3H,1-2,5H2,(H,6,7)(H2,8,9,10)/t3-/m0/s1 ☒N
  • Key:DDOQBQRIEWHWBT-VKHMYHEASA-N ☒N
 ☒NcheckY (what is this?)  (verify)

L-AP4 (L-2-amino-4-phosphonobutyric acid) is a drug used in scientific research, which acts as a group-selective agonist for the group III metabotropic glutamate receptors (mGluR4/6/7/8). It was the first ligand found to act as an agonist selective for this group of mGlu receptors,[1] but does not show selectivity between the different mGluR Group III subtypes. It is widely used in the study of this receptor family and their various functions.[2][3][4][5]

References

[edit]
  1. ^ Thomsen C (August 1997). "The L-AP4 receptor". General Pharmacology. 29 (2): 151–8. doi:10.1016/S0306-3623(96)00417-X. PMID 9251893.
  2. ^ Lopez S, Turle-Lorenzo N, Acher F, De Leonibus E, Mele A, Amalric M (June 2007). "Targeting group III metabotropic glutamate receptors produces complex behavioral effects in rodent models of Parkinson's disease". The Journal of Neuroscience. 27 (25): 6701–11. doi:10.1523/JNEUROSCI.0299-07.2007. PMC 6672706. PMID 17581957.
  3. ^ Macinnes N, Duty S (February 2008). "Group III metabotropic glutamate receptors act as hetero-receptors modulating evoked GABA release in the globus pallidus in vivo". European Journal of Pharmacology. 580 (1–2): 95–9. doi:10.1016/j.ejphar.2007.10.030. PMID 18035348.
  4. ^ Zhang HM, Chen SR, Pan HL (January 2009). "Effects of activation of group III metabotropic glutamate receptors on spinal synaptic transmission in a rat model of neuropathic pain". Neuroscience. 158 (2): 875–84. doi:10.1016/j.neuroscience.2008.10.042. PMC 2649787. PMID 19017536.
  5. ^ Maciejak P, Szyndler J, Turzyńska D, Sobolewska A, Taracha E, Skórzewska A, et al. (July 2009). "The effects of group III mGluR ligands on pentylenetetrazol-induced kindling of seizures and hippocampal amino acids concentration". Brain Research. 1282: 20–7. doi:10.1016/j.brainres.2009.05.049. PMID 19481536. S2CID 20844494.
Stub icon

This drug article relating to the nervous system is a stub. You can help Wikipedia by expanding it.

Retrieved from "https://en.wikipedia.org/w/index.php?title=L-AP4&oldid=1175817150"